3-Methylglutaric acid
3-Methylglutaric acid (MGA, 3MG acid) is a conspicuous C6 dicarboxylic organic acid that can be used as a single solid-state NMR standard compound to perform all calibration steps except for magnet shimming.
| Trivial name | MGA, 3MG acid |
| Catalog Number | S3347 |
| Molecular Formula | C15H18N4O5 |
| CAS# | 626-51-7 |
| Inchi | InChI=1S/C15H18N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h6-7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/t6-,7+,13+,15-/m1/s1 |
| Inchi Key | NWIBSHFKIJFRCO-WUDYKRTCSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/3-methylglutaric-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3347-3-methylglutaric-acid-chemical-structure.gif |
