Captopril 10mM * 1mL in DMSO
Captopril is an angiotensin-converting enzyme (ACE) inhibitor used for the treatment of hypertension and some types of congestive heart failure.
| Trivial name | Captopril 10mM * 1mL in DMSO |
| Catalog Number | A11738-10mM-D |
| Alternative Name(s) | (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| Molecular Formula | C9H15NO3S |
| CAS# | 62571-86-2 |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/captopril.html |