(3-Carboxypropyl)trimethylammonium chloride
(3-Carboxypropyl)trimethylammonium chloride is a synthetic carnitine related compound used as a transporter substrate in the cloning and sequencing of human carnitine transporter 2 (CT2).
| Catalog Number | T4702 |
| Alternative Name(s) | γ-Butyrobetaine hydrochloride , (3-Carboxypropyl)trimethylammonium chlor |
| Research Area | Metabolism |
| Molecular Formula | C7H16ClNO2 |
| CAS# | 6249-56-5 |
| SMILES | [Cl-].C[N+](C)(C)CCCC(O)=O |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/(3-Carboxypropyl)trimethylammonium chloride |
| Additional Information | https://www.targetmol.com/datasheet/T4702 |
