3,3-Dimethyl-1-butanol
3,3-Dimethyl-1-butanol (Neohexanol) is an orally active inhibitor of trimethylamine (TMA) and trimethylamine N-oxide (TMAO). 3,3-dimethyl-1-butanol negatively inhibits the signalling pathways of p65 NF-κB and TGF-β1/Smad3. 3,3-dimethyl-1-butanol has potential applications in cardiovascular disease (CVD).
| Trivial name | Neohexanol |
| Catalog Number | E4432 |
| Molecular Formula | C50H57NO17 |
| CAS# | 624-95-3 |
| SMILES | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)OC8C(C(C(CO8)O)O)O)C)O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/3-3-dimethyl-1-butanol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e4432-3-3-Dimethyl-1-butanol-chemical-structure.png |
