Oxytocin acetate
Oxytocin (α-Hypophamine) acetate is a pleiotropic, hypothalamic peptide known for facilitating parturition, lactation, and prosocial behaviors. Oxytocin acetate can function as a stress-coping molecule with anti-inflammatory, antioxidant, and protective effects especially in the face of adversity or trauma.
| Trivial name | α-Hypophamine acetate; Oxytocic hormone acetate |
| Catalog Number | E8197 |
| Molecular Formula | C7H10O5 |
| CAS# | 6233-83-6 |
| Inchi | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4?,5-,6?/m1/s1 |
| Inchi Key | JXOHGGNKMLTUBP-INWUZDNDSA-N |
| SMILES | C1C(C(C(C=C1C(=O)O)O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/oxytocin-acetate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e8197-oxytocin-acetate-chemical-structure-tube.png |
