tert-Butyl 2-(dimethoxyphosphoryl)acetate
Tert-Butyl 2-(dimethoxyphosphoryl)acetate is reactant for preparation of phosphonate terminated PPH dendrimers as anti-HIV-1 agents and preparation of monodehydro diketopiperazines from ketoacyl amino acid amides via acid-catalyzed cyclization etc.
| Trivial name | Dimethyl (Boc-methyl)phosphonate; Synonym Dimethyl (tert-Butoxycarbonylmethyl)phosphonate; Synonym Dimethylphosphonoacetic Acid tert-Butyl Ester |
| Catalog Number | CSN25498 |
| Alternative Name(s) | Dimethyl (Boc-methyl)phosphonate; Synonym Dimethyl (tert-Butoxycarbonylmethyl)phosphonate; Synonym Dimethylphosphonoacetic Acid tert-Butyl Ester |
| Research Area | / |
| Molecular Formula | C8H17O5P |
| CAS# | 62327-21-3 |
| Purity | ≥98% |
| SMILES | O=C(OC(C)(C)C)CP(OC)(OC)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tert-butyl-2-(dimethoxyphosphoryl)acetate.html |