Desmopressin Acetate
A synthetic analog of the pituitary hormone, ARGININE VASOPRESSIN. Its action is mediated by the VASOPRESSIN receptor V2. It has prolonged antidiuretic activity, but little pressor effects. It also modulates levels of circulating FACTOR VIII and VON WILLEBRAND FACTOR
| Catalog Number | API62288839 |
| Alternative Name(s) | Octostim Minirine Stimate CONCENTRAID |
| Research Area | Peptide APIs |
| Molecular Formula | C48H68N14O14S2 |
| CAS# | 62288-83-9 |
| SMILES | CC(=O)O.C1CC(N(C1)C(=O)C2CSSCCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2)CC(=O)N)CCC(=O)N)CC3=CC=CC=C3)CC4=CC=C(C=C4)O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/desmopressin-acetate-item-11651.html |