epsilon-Viniferin
epsilon-Viniferin, a natural product isolated and purified from the stem of Gnetum montanum Markgr., shows a human cytochrome P450 enzymes inhition activity, and slightly reduces cell proliferation but might protect from cell degenerescence.
| Trivial name | ε-Viniferin |
| Catalog Number | CSN14396 |
| Alternative Name(s) | ε-Viniferin |
| Research Area | Infection |
| Molecular Formula | C28H22O6 |
| CAS# | 62218-08-0 |
| Purity | ≥98% |
| SMILES | OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC(O)=CC(/C=C/C5=CC=C(O)C=C5)=C24)=CC(O)=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/epsilon-viniferin.html |