Docosahexaenoic acid
Fatty Acid Derivatives
| Trivial name | NULL |
| Catalog Number | CS-P-00408 |
| Alternative Name(s) | DHA;Cervonic Acid;all-Z)-4,7,10,13,16,19-Docosahexaenoic Acid;(all-Z)-4,7,10,13,16,19-Docosahexaenoic Acid; DHA; Cervonic Acid; Doconexent; Marinol D 50TG; Ropufa 60; |
| Research Area | Omega-3 fatty acid found in marine fish oils and in many phospholipids. Major structural component of excitable membranes of the retina and brain; synthesized in the liver from α-linolenic acid. Nutritional supplement. |
| Molecular Formula | C22H32O2 |
| CAS# | 6217-54-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC/C=CC/C=CC/C=CC/C=CC/C=CC/C=CCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSP00408.html |
| Additional Information | NULL |