Bendazol
Bendazol (2-Benzylbenzimidazole, Dibazol, Dibazole, Bendazole, Tromasedan) is a hypotensive drug that enhances NO synthase activity in renal glomeruli and collecting tubules. Bendazol inhibits the progression of form-deprivation myopia (FDM) and suppresses the upregulation of HIF-1α.
| Trivial name | 2-Benzylbenzimidazole, Dibazol, Dibazole, Bendazole, Tromasedan |
| Catalog Number | S3589 |
| Molecular Formula | C14H12N2 |
| CAS# | 621-72-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C(C1=NC2=CC=CC=C2[NH]1)C3=CC=CC=C3 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/bendazol.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3589-bendazol-chemical-structure.gif |