3-(3-Hydroxyphenyl)propionic Acid
3-(3-Hydroxyphenyl)propionic acid (m-Hydroxyphenylpropionic acid, 3-Hydroxyhydrocinnamic acid) is one of the major metabolites of ingested caffeic acid and of the phenolic degradation products of proanthocyanidins by the microflora in the colon.
| Trivial name | m-Hydroxyphenylpropionic acid, 3-Hydroxyhydrocinnamic acid |
| Catalog Number | S6074 |
| Molecular Formula | C9H10O3 |
| CAS# | 621-54-5 |
| Inchi | InChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| Inchi Key | QVWAEZJXDYOKEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)CCC(=O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/3-3-hydroxyphenyl-propionic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/3-3-hydroxyphenyl-propionic-acid-chemical-structure-s6074.gif |