3-Nitro-L-tyrosine
3-Nitro-L-tyrosine (3-NT, N-Tyr, MNT), synthesized from L-tyrosine by peroxynitrite, is a product of nitric oxide and superoxide. 3-Nitro-L-tyrosine inhibits the hemodynamic responses to angiotensin II, possibly through the inhibition of alpha 1-adrenoceptor-mediated events.
| Trivial name | 3-NT, N-Tyr, MNT |
| Catalog Number | S6345 |
| Molecular Formula | C9H10N2O5 |
| CAS# | 621-44-3 |
| SMILES | NC(CC1=CC(=C(O)C=C1)[N+]([O-])=O)C(O)=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/3-nitro-l-tyrosine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6345-3-nitro-l-tyrosine-chemical-structure.gif |