Morin hydrate 500mg
Morin hydrate is a chemical compound. Morin can be used to test for the presence of aluminum or tin in a solution, since it forms characteristically fluorescent coordination complexes with them.
Trivial name | Morin hydrate 500mg |
Catalog Number | A10605-500 |
Alternative Name(s) | 2',3,4',5,7-Pentahydroxyflavone |
Molecular Formula | C15H12O8 |
CAS# | 6202-27-3 |
SMILES | C1=CC(=C(C=C1O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O.O |
Size | 500mg |
Supplier Page | http://www.adooq.com/morin-hydrate.html |