Cyclobenzaprine Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-07714 |
| Alternative Name(s) | 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine hydrochloride; Amitriptyline hydrochloride EP Impurity B |
| Research Area | Cyclobenzaprine Hydrochloride is a centrally acting muscle relaxant, chemically similar to amitriptyline hydrochloride with antidepressant activity. The exact mechanism of action of cyclobenzaprine hydrochloride has not been fully determined. However, it |
| Molecular Formula | C₂₀H₂₂ClN |
| CAS# | 6202-23-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)CC/C=C1C2=CC=CC=C2C=CC3=C1C=CC=C3.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07714.html |
| Additional Information | NULL |