Dirithromycin
Dirithromycin is a semi-synthetic macrolide antibiotic pro-drug used to treat many different types of bacterial infections, such as bronchitis, pneumonia, tonsillitis, and even skin infections.

Trivial name | LY-237216; ASE-136 |
Catalog Number | CSN10836 |
Alternative Name(s) | LY-237216; ASE-136 |
Research Area | Infection |
Molecular Formula | C42H78N2O14 |
CAS# | 62013-04-1 |
Purity | ≥98% |
SMILES | CC1[C@@]([C@](O)([C@H](OC([C@@H]2C)=O)CC)C)([H])O[C@H](COCCOC)N[C@@]1([H])[C@](C[C@@](O)([C@@H]([C@@H](C)[C@]2([H])O[C@@](O[C@@H](C)[C@@H]3O)([H])C[C@@]3(C)OC)O[C@@](O[C@H](C)C[C@@H]4N(C)C)([H])[C@@H]4O)C)([H])C |
Size | 1g |
Supplier Page | https://www.csnpharm.com/products/dirithromycin.html |