Calcium is a mineral supplement.
| Catalog Number | API0231895 |
| Alternative Name(s) | Calcium acetate; 62-54-4; Calcium diacetate |
| Research Area | API |
| Molecular Formula | C4H6CaO4 |
| CAS# | 62-54-4 |
| Inchi | InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| Inchi Key | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Ca+2] |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/calcium-acetate-item-395.html |
Calcium Acetate is a calcium salt of acetic acid. Calcium is a mineral essential for many cellular functions including nerve impulse transmission, muscle contraction, cardiac function, bone formation, and capillary and cell membrane permeability. Calcium acetate is administered orally to prevent or treat calcium deficiency and to treat hyperphosphatemia due to its phosphate-binding properties.
| Catalog Number | PIE-0304 |
| Alternative Name(s) | Calcium diacetate Acetic acid, calcium salt Lime acetate |
| Research Area | Corrective Agents |
| Molecular Formula | C4H6O4.Ca |
| CAS# | 62-54-4 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Ca+2] |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/calcium-acetate-item-12116.html |
