Triciribine phosphate 10mM * 1mL in DMSO
Triciribine phosphate inhibits the phosphorylation, activation, and signalling of Akt-1, -2, and -3, which may result in the inhibition of Akt-expressing tumor cell proliferation.
| Trivial name | Triciribine phosphate 10mM * 1mL in DMSO |
| Catalog Number | A11033-10mM-D |
| Alternative Name(s) | ((2R,3S,4R,5R)-5-(3-amino-5-methyl-1,4,5,6,8-pentaazaacenaphthylen-1(5H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogen phosphate |
| Molecular Formula | C13H17N6O7P |
| CAS# | 61966-08-3 |
| SMILES | CN1C2=NC=NC3=C2C(=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)COP(=O)(O)O)O)O)C(=N1)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/triciribine-phosphate-nsc-280594.html |
