Dihydroergotamine Mesylate
α-Androgenic blocker with selective venoconstrictor properties. Also binds to serotonin 5HT1-receptors. Antimigraine.
| Catalog Number | CS-O-30891 |
| Alternative Name(s) | Dihydroergotamine mesylate; Dihydroergotamine mesilate; Dihydroergotamine methanesulfonate; (5?α,10α)-9,10-Dihydro-12?-hydroxy-2?-methyl-5?-(phenylmethyl)ergotaman-3?,6?,18-trione Methanesulfonate; 9,10-Dihydroergotamine Monomethanesulfonate (Salt); (+)-Dihydroergotamine Mesylate; Dihytamine; Dirgotarl; Endophleban; Ergomimet; Ergont; Ergotonin; Ikaran; Migranal; Morena; Orstanorm; Seglor; Tonopres; Verladyn; |
| Research Area | Metabolites |
| Molecular Formula | C33H37N5O5.CH3SO3H |
| CAS# | 6190-39-2 |
| Purity | >98% |
| SMILES | C[S](=O)(O)=O.O[C@@]([C@@](CCC1)([H])N1C2=O)(O[C@](NC([C@@H](CN(C)[C@]3([H])C4)C[C@]3([H])C5=C6C4=CNC6=CC=C5)=O)(C)C7=O)N7[C@H]2CC8=CC=CC=C8 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30891.html |
