4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) | MedChemExpress (MCE)
4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) is a nitro compound used as a reactant in drug synthesis. 4-Nitrobenzyl alcohol can be catalyzed to 4-nitrobenzaldehyde by the enzyme encoded by the benzyl alcohol dehydrogenase gene (ntnD)[1].
![](https://smallmolecules.com/sm/wp-content/uploads/products/medchem-express/56/5602490220501685843-14.jpg)
Trivial name | 4-Nitrobenzyl alcohol (4-Nitrobenzenemathanol) |
Catalog Number | HY-W015570 |
Alternative Name(s) | 4-Nitrobenzenemathanol; 4-Nitrobenzyl alcohol |
Research Area | Others |
CAS# | 619-73-8 |
Purity | ≥98.0% |
SMILES | OCC1=CC=C([N+]([O-])=O)C=C1 |
Size | 25 g |
Supplier Page | https://www.medchemexpress.com/4-nitrobenzyl-alcohol-4-nitrobenzenemathanol.html |