Oxaliplatin 50mg
Oxaliplatin is a platinum-based antineoplastic agent that is used in cancer chemotherapy. In vivo studies showed that Oxaliplatin has anti-tumor activity against colon carcinoma through its (non-targeted) cytotoxic effects.
| Trivial name | Oxaliplatin 50mg |
| Catalog Number | A10346-50 |
| Alternative Name(s) | [(1R,2R)-cyclohexane-1,2-diamine](ethanedioato-O,O')platinum(II) |
| Molecular Formula | C8H14N2O4Pt |
| CAS# | 61825-94-3 |
| SMILES | O=C3O[Pt]1(N[C@@H]2CCCC[C@H]2N1)OC3=O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/oxaliplatin-eloxatin.html |
