Fluvoxamine D4 Maleate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06634 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Fluvoxamine, intended for use as an internal standard for the quantification of Fluvoxamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H21D4F3N2O6 |
| CAS# | 61718-82-9 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=CC(O)=O)=O.NC([2H])(C([2H])(O/N=C(CCCCOC)/C1=CC=C(C=C1)C(F)(F)F)[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06634.html |
| Additional Information | NULL |