(R)-MDA
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02267 |
| Alternative Name(s) | (RMDA) R(-)-[(diphenylmethyl)sulphenyl]acetic acid;(R)-Mda; (R)-β-3,4-(Methylenedioxy)amphetamine; (R)-α-Methyl-1,3-benzodioxole-5-ethanamine; (R)-α-Methyl-3,4-(methylenedioxy)phenethylamine; Phenethylamine, α-methyl-3,4-(methylenedioxy)-, (R)-; AC1MIJOZ; (R)-Tenamfetamine |
| Research Area | R-MDA is a psychoactive drug of the substituted methylenedioxyphenethylamine and substituted amphetamine classes of drugs that is consumed primarily for its entactogenic, psychedelic, and psychostimulant effects. |
| Molecular Formula | C10H13NO2 |
| CAS# | 61614-60-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](N)CC1=CC=C2C(OCO2)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02267.html |
| Additional Information | NULL |