15-Keto-PGA1 | MedChemExpress (MCE)
15-Keto-PGA1 is a metabolite of PGA1 and has significant vasoconstrictive effects. PGA1 is also a vasoconstrictor and is more potent than equivalent doses of prostaglandin F2α (PGF2α) and angiotensin II[1].
| Trivial name | 15-Keto-PGA1 |
| Catalog Number | HY-137024 |
| Research Area | Cardiovascular Disease |
| CAS# | 61600-67-7 |
| Purity | ≥98.0% |
| SMILES | CCCCCC(/C=C/[C@@H]1[C@H](C(C=C1)=O)CCCCCCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-keto-pga1.html |