Lycorine Hydrochloride Monohydrate | MedChemExpress (MCE)
Lycorine Hydrochloride Monohydrate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Lycorine Hydrochloride Monohydrate |
| Catalog Number | HY-N0288A |
| Research Area | Others |
| CAS# | 6150-58-9 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@]2([H])[C@]3([H])N(CCC3=C[C@@H]1O)CC4=CC(OCO5)=C5C=C24.O.Cl |
| PubChem Chemical Structure ID | 70446239 |
| Size | 250 mg |
| Supplier Page | https://www.medchemexpress.com/lycorine-hydrochloride-monohydrate.html |