alpha-Mangostin
alpha-Mangostin is a dietary xanthone with broad biological activities, such as antioxidant, anti-allergic, antiviral, antibacterial, anti-inflammatory and anticancer effects. It is an inhibitor of mutant IDH1 (IDH1-R132H) with a Ki of 2.85 μM.
| Trivial name | α-Mangostin |
| Catalog Number | CSN17082 |
| Alternative Name(s) | α-Mangostin |
| Research Area | / |
| Molecular Formula | C24H26O6 |
| CAS# | 6147-11-1 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(OC3=C1C(C/C=C(C)\C)=C(OC)C(O)=C3)C=C(O)C(C/C=C(C)\C)=C2O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/alpha-mangostin.html |
