4-Methylphenyl benzoate
4-Methylphenyl benzoate is an ester. Structure of 4-methylphenyl benzoate resembles phenyl benzoate and 4-methoxy-phenyl benzoate, in terms of similar geometric parameters. The dihedral angle between the phenyl and benzene rings in 4-methylphenyl benzoate is 60. 17 (7)°. Fries rearrangement of 4-methoxy-phenyl benzoate catalyzed by sulfated zirconia is reported.
| Catalog Number | CBB1120822 |
| Alternative Name(s) | p-Tolyl benzoate |
| Molecular Formula | C6H5CO2C6H4CH3 |
| CAS# | 614-34-6 |
| Purity | >99% |
| Inchi | 1S/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| Inchi Key | LLRZUDIHEZXFGV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)c2ccccc2)cc1 |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/4-methylphenyl-benzoate-item-120822.html |