D-(+)-Trehalose dihydrate
Trehalose is a non-reducing sugar. It is thought to provide plants and animals with the ability to withstanding periods of dehydration.
| Trivial name | D-Trehalose dihydrate;α,α-Trehalose dihydrate |
| Catalog Number | CSN24959 |
| Alternative Name(s) | D-Trehalose dihydrate;α,α-Trehalose dihydrate |
| Research Area | / |
| Molecular Formula | C12H26O13 |
| CAS# | 6138-23-4 |
| Purity | ≥97% |
| SMILES | O[C@H]1[C@@H]([C@H](O[C@@H]([C@@H]1O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CO)O.[H]O[H].[H]O[H] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/d-(+)-trehalose-dihydrate.html |