MB327 | MedChemExpress (MCE)
MB327 is a bipyridine nonoxime compound that restores neuromuscular function. MB327 restores the activity of nicotinamide acetylcholine receptors (nAChRs) for carbachol desensitization in a typical type II PAM manner. MB327 can neutralize nerve agent poisoning[1][2].
| Trivial name | MB327 |
| Catalog Number | HY-161118 |
| Research Area | Neurological Disease |
| CAS# | 61368-98-7 |
| Purity | ≥98.00% |
| SMILES | CC(C)(C)C1=CC=[N+](CCC[N+]2=CC=C(C(C)(C)C)C=C2)C=C1.[I-].[I-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mb327.html |