M62812 | MedChemExpress (MCE)
M62812 is a toll-like receptor 4 (TLR4) signaling inhibitor. M62812 inhibits endothelial and leukocyte activation and prevents lethal septic shock in mice. M62812 can reduces LPS-induced coagulation and inflammatory responses. M62812 can be used for the research of sepsis[1].
| Trivial name | M62812 |
| Catalog Number | HY-103639A |
| Research Area | Infection |
| CAS# | 613263-00-6 |
| Purity | 99.86% |
| SMILES | NC1=NSC2=C1C=CC(OC3=CC=CC=C3N)=C2.[H]Cl.[H]Cl |
| PubChem Chemical Structure ID | 44224214 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/m62812.html |