Isoacteoside
Isoacteoside is a natural compound isolated and purified from the herb of Pedicularis striata Pall. which exhibit significant inhibition of advanced glycation end product formation with IC50 values of 4.6-25.7 μM, compared with those of aminoguanidine (IC50=1,056 μM) and quercetin (IC50=28.4 μM) as positive controls, and exhibits anti-inflammatory effects through blocking TLR4 dimerization.
| Trivial name | Isoverbascoside |
| Catalog Number | CSN15672 |
| Alternative Name(s) | Isoverbascoside |
| Research Area | / |
| Molecular Formula | C29H36O15 |
| CAS# | 61303-13-7 |
| Purity | ≥98% |
| SMILES | O=C(/C=C/C1=CC=C(O)C(O)=C1)OC[C@H]2O[C@@H](OCCC3=CC=C(O)C(O)=C3)[C@H](O)[C@H]([C@@H]2O)O[C@H](O[C@@H](C)[C@@H]4O)[C@@H]([C@@H]4O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/isoacteoside.html |