AKT inhibitor VIII 5mg
AKT inhibitor VIII is a cell-permeable and reversible quinoxaline compound that potently and selectively inhibits Akt1/Akt2 activity (IC50 = 58 nM, 210 nM, and 2.12 ?M for Akt1, Akt2, and Akt3, respectively, in in vitro kinase assays).
| Trivial name | AKT inhibitor VIII 5mg |
| Catalog Number | A11286-5 |
| Alternative Name(s) | 1,3-Dihydro-1-[1-[[4-(6-phenyl-1H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]-4-piperidinyl]-2H-benzimidazol-2-one |
| Molecular Formula | C34H29N7O |
| CAS# | 612847-09-3 |
| SMILES | C1CN(CCC1N2C3=CC=CC=C3NC2=O)CC4=CC=C(C=C4)C5=NC6=CC7=C(C=C6N=C5C8=CC=CC=C8)N=CN7 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/akt-inhibitor-viii-akti-1-2.html |
