Acteoside
Acteoside, is a natural product isolated and purified from the herbs of Cistanche deserticola Y.C. Ma with known antioxidant activity. It is a protein kinase C inhibitor (IC50 =25 μM).
| Trivial name | Kusaginin; TJC160; Verbascoside |
| Catalog Number | CSN11220 |
| Alternative Name(s) | Kusaginin; TJC160; Verbascoside |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C29H36O15 |
| CAS# | 61276-17-3 |
| Purity | ≥99% |
| SMILES | O=C(O[C@@H]1[C@@H](CO)O[C@@H](OCCC2=CC=C(O)C(O)=C2)[C@H](O)[C@H]1O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)/C=C/C4=CC=C(O)C(O)=C4 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/acteoside.html |