Cefonicid Sodium
Cefonicid sodium is a cephalosporin antibiotic, interfering with cell wall biosynthesis in bacteria, leading to lysis of the infectious organism.
| Trivial name | Cefonicid Disodium Salt |
| Catalog Number | CSN10574 |
| Alternative Name(s) | Cefonicid Disodium Salt |
| Research Area | Infection |
| Molecular Formula | C₁₈H₁₆N₆Na₂O₈S₃ |
| CAS# | 61270-78-8 |
| SMILES | O=C(C(N12)=C(CSC3=NN=NN3CS(=O)([O-])=O)CS[C@]2([H])[C@H](NC([C@H](O)C4=CC=CC=C4)=O)C1=O)[O-].[Na+].[Na+] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cefonicid-sodium.html |