Icotinib 10mM * 1mL in DMSO
Icotinib is a potent and specific EGFR inhibitor with IC50 of 5 nM, including the EGFR, EGFR(L858R), EGFR(L861Q), EGFR(T790M) and EGFR(T790M, L858R).
Trivial name | Icotinib 10mM * 1mL in DMSO |
Catalog Number | A13825-10mM-D |
Alternative Name(s) | N-(3-Ethynylphenyl)-7,8,10,11,13,14-hexahydro-[1,4,7,10]tetraoxacyclododecino[2,3-g]quinazolin-4-amine |
Molecular Formula | C22H21N3O4 |
CAS# | 610798-31-7 |
SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC4=C(C=C32)OCCOCCOCCO4 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/icotinib.html |