4-Amino-3-nitrophenol
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-03148 |
| Alternative Name(s) | 2-Amino-5-hydroxynitrobenzene;2-Amino-5-hydroxynitrobenzene;4-amino-3-nitrophenol |
| Research Area | An aminonitrophenol isomer used in hair dyes, potent human skin sensitizers and other cosmetic products with very low levels of mutagenic activity. |
| Molecular Formula | C6H6N2O3 |
| CAS# | 610-81-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[N](C(C=C(O)C=C1)=C1N)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST03148.html |
| Additional Information | NULL |