Phenylephrine hydrochloride 10mM * 1mL in DMSO
Phenylephrine is a selective ??1-adrenergic receptor agonist used primarily as a decongestant, as an agent to dilate the pupil, and to increase blood pressure.
| Trivial name | Phenylephrine hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A11666-10mM-D |
| Alternative Name(s) | (R)-(-)-1-(3-Hydroxyphenyl)-2-methylaminoethanol hydrochloride |
| Molecular Formula | C9H13NO2.HCl |
| CAS# | 61-76-7 |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/phenylephrine-hydrochloride.html |