Phenylephrine hydrochloride 10mM * 1mL in DMSO
Phenylephrine is a selective ??1-adrenergic receptor agonist used primarily as a decongestant, as an agent to dilate the pupil, and to increase blood pressure.
Trivial name | Phenylephrine hydrochloride 10mM * 1mL in DMSO |
Catalog Number | A11666-10mM-D |
Alternative Name(s) | (R)-(-)-1-(3-Hydroxyphenyl)-2-methylaminoethanol hydrochloride |
Molecular Formula | C₉H₁₃NO₂.HCl |
CAS# | 61-76-7 |
SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/phenylephrine-hydrochloride.html |