Methylene Blue
Methylene blue is a synthetic basic dye used in chromoendoscopy to identify dysplasia, or pre-cancerous lesions. It also can stain cells and tissues in research.It also works as a soluble guanylyl cyclase inhibitor.
| Trivial name | Basic Blue 9; Tetramethylthionine Chloride; Methylthioninium Chloride; CI 52015 |
| Catalog Number | CSN11419 |
| Alternative Name(s) | Basic Blue 9; Tetramethylthionine Chloride; Methylthioninium Chloride; CI 52015 |
| Research Area | / |
| Molecular Formula | C16H18ClN3S |
| CAS# | 61-73-4 |
| Purity | ≥99% |
| SMILES | CN(C1=CC2=[S+]C3=C(C=CC(N(C)C)=C3)N=C2C=C1)C.[Cl-] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/methylene-blue.html |