Dibucaine Hydrochloride
Dibucaine HCl is a local anesthetics.Among the most potent and toxic of the long-acting local anesthetics, current use of it is generally restricted to spinal and topical anesthesia.
| Catalog Number | API61121 |
| Alternative Name(s) | Cinchocaine hydrochloride Dibucaine HCl Dibucaine (hydrochloride) |
| Research Area | Anesthetic Analgesia APIs |
| Molecular Formula | C20H30ClN3O2 |
| CAS# | 61-12-1 |
| SMILES | CCCCOC1=NC2=CC=CC=C2C(=C1)C(=O)NCCN(CC)CC.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dibucaine-hydrochloride-item-6306.html |