LVGRQLEEFL (mouse) | MedChemExpress (MCE)
LVGRQLEEFL (mouse) can be named as G * peptide, corresponding to amino acids 113 to 122 in apolipoprotein J ([113,122] apoJ)}. LVGRQLEEFL (mouse) exhibits anti-inflammatory and anti-atherogenic properties. LVGRQLEEFL (mouse) can be added to an apoJ mimetic, to form HM-10/10 peptide, which is a mimetic peptide and a novel chimeric high density lipoprotein. HM-10/10 peptide protects retinal pigment epithelium (RPE) and photoreceptors from oxidant induced cell death[1][2].
| Trivial name | LVGRQLEEFL (mouse) |
| Catalog Number | HY-P5169 |
| Research Area | Inflammation/Immunology |
| CAS# | 608513-82-2 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H](C(C)C)C(NCC(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC(C)C)C(N[C@@H](CCC(O)=O)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(C)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CC(C)C)N |
| PubChem Chemical Structure ID | 10219303 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lvgrqleefl-mouse.html |