Pentabromophenol | MedChemExpress (MCE)
Pentabromophenol (PBP) is a brominated flame retardant (BFR) widely used in various consumer products to reduce the flammability of materials used in different utility items. Pentabromophenol can accelerate the degradation of transforming growth factor-β (TGF-β) receptors by promoting clathrin-mediated endocytosis, thereby inhibiting the TGF-β signaling pathway. Additionally, Pentabromophenol can also induce apoptosis in peripheral blood mononuclear cells (PBMCs)[1][2].

Trivial name | Pentabromophenol |
Catalog Number | HY-W105318 |
Alternative Name(s) | PBP |
Research Area | Cancer |
CAS# | 608-71-9 |
Purity | ≥98.0% |
SMILES | C1(=C(C(=C(C(=C1Br)Br)O)Br)Br)Br |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/pentabromophenol.html |