Bifonazole
Bifonazole is a substituted imidazole antifungal agent, working by inhibiting the production of ergosterol, which is an essential component of fungal cell membranes.
| Trivial name | BAY H 4502; Trifonazole |
| Catalog Number | CSN16770 |
| Alternative Name(s) | BAY H 4502; Trifonazole |
| Research Area | Infection |
| Molecular Formula | C22H18N2 |
| CAS# | 60628-96-8 |
| Purity | ≥99% |
| SMILES | N1(C(C2=CC=C(C3=CC=CC=C3)C=C2)C4=CC=CC=C4)C=CN=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/bifonazole.html |