NADH Disodium
NADH Disodium is a coenzyme that functions as a regenerating electron donor in catabolic processes including glycolysis, β-oxidation and the citric acid cycle.
| Trivial name | Disodium NADH |
| Catalog Number | CSN10430 |
| Alternative Name(s) | Disodium NADH |
| Research Area | / |
| Molecular Formula | C21H27N7Na2O14P2 |
| CAS# | 606-68-8 |
| Purity | ≥98% |
| SMILES | NC1=C2C(N([C@H]3[C@H](O)[C@H](O)[C@@H](COP(OP([O-])(OC[C@@H]4[C@@H](O)[C@@H](O)[C@H](N5C=C(C(N)=O)CC=C5)O4)=O)([O-])=O)O3)C=N2)=NC=N1.[Na+].[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/nadh-disodium.html |