Cyclophosphamide Monohydrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-06288 |
| Alternative Name(s) | N,N-Bisxazaphosphorin-2-amine 2-Oxide MonHydroxyydratclostin;cytoxan; Endoxan; Genoxal; Hexadrin; Mitoxan; Nc 26271; |
| Research Area | It is a cytotoxic nitrogen mustard derivative widely used in cancer chemotherapy. It cross-links DNA, causes strand breakage, and induces mutations. Its clinical activity is associated with a decrease in aldehyde dehydrogenase 1 (ALDH1) activity. This sub |
| Molecular Formula | C7H1Cl2N2O3P |
| CAS# | 6055-19-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[P]1(NCCCO1)N(CCCl)CCCl.O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06288.html |
| Additional Information | NULL |