Zimelidine dihydrochloride
Zimelidine dihydrochloride is a 5-HT reuptake inhibitor with selectivity over noradrenalin and dopamine uptake (IC50 = 0.33, 8.2 and 12 μM, respectively). Zimelidine modulates nociception and induces hyperglycemia in vivo, and is used as an orally active antidepressant.
| Catalog Number | 60525-15-7 |
| Alternative Name(s) | (2Z)-3-(4-Bromophenyl)-N,N-dimethyl-3-(3-pyrindinyl)-2-propen-1-amine dihydrochloride; Normud; Zelmid; Zimeldine dihydrochloride; Zimelidine hydrochloride |
| Molecular Formula | C16H17BrN2.2HCl |
| CAS# | 60525-15-7 |
| Purity | ≥98% |
| Inchi | InChI=1S/C16H17BrN2.2ClH/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13;;/h3-10,12H,11H2,1-2H3;2*1H/b16-9-;; |
| Inchi Key | CXGURXWCQYHDIR-ULPVBNQHSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/zimelidine-dihydrochloride-cas-60525-15-7-item-170443.html |