Pifithrin-β
Pifithrin-β is a potent p53 inhibitor with IC50 of 23 μM in an antiproliferative assay in the human ovarian carcinoma cell line, IGROV-1.
| Trivial name | Cyclic Pifithrin-α; Cyclic Pifithrin-alpha; Pifithrin-beta |
| Catalog Number | CSN18356 |
| Alternative Name(s) | Cyclic Pifithrin-α; Cyclic Pifithrin-alpha; Pifithrin-beta |
| Research Area | Cancer |
| Molecular Formula | C16H16N2S |
| CAS# | 60477-34-1 |
| Purity | ≥98% |
| SMILES | CC1=CC=C(C2=CN3C(SC4=C3CCCC4)=N2)C=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/pifithrin-b.html |