Leucovorin (Folinic acid) Calcium Pentahydrate
Leucovorin (Folinic acid) Calcium Pentahydrate is a derivative of folic acid, which can be used to increase levels of folic acid under conditions favoring folic acid inhibition.Solutions are unstable and should be fresh-prepared.
| Trivial name | NSC-3590 Calcium Pentahydrate, Calcium Folinatc, Citrovorum Factor |
| Catalog Number | S1236 |
| Molecular Formula | C15H12ClNO |
| CAS# | 6035-45-6 |
| Inchi | InChI=1S/C15H12ClNO/c1-10-2-4-11(5-3-10)14-9-18-15-8-12(16)6-7-13(15)17-14/h2-8H,9H2,1H3 |
| Inchi Key | MVOZLTFXYGHZPM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)OC2 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Leucovorin-Calcium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Leucovorin-Calcium-chemical-structure-S1236.gif |