Odanacatib
Odanacatib is a potent, selective, and neutral inhibitor of cathepsin K (human/rabbit) with IC50 of 0.2 nM/1 nM, and demonstrated high selectivity versus off-target cathepsin B, L, S. Phase 3.
| Trivial name | MK-0822 |
| Catalog Number | S1115 |
| Molecular Formula | C21H27N7Na2O14P2 |
| CAS# | 603139-19-1 |
| Inchi | InChI=1S/C21H29N7O14P2.2Na/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33;;/h1,3-4,7-8,10-11,13-16,20-21,29- 32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25);;/q;2*+1/p-2/t10-,11-,13-,14-,15-,16-,20-,21-;;/m1../s1 |
| Inchi Key | QRGNQKGQENGQSE-WUEGHLCSSA-L |
| SMILES | C1C=CN(C=C1C(=O)N)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O.[Na+].[Na+] |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/Odanacatib-(MK0822).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Odanacatib-MK0822-chemical-structure-S1115.gif |
