3-Nitrophthalic acid | MedChemExpress (MCE)
3-Nitrophthalic acid (m-Nitrophthalic acid; o-Nitrophthalic acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
![](https://smallmolecules.com/sm/wp-content/uploads/products/medchem-express/56/5602490220501685843-14.jpg)
Trivial name | 3-Nitrophthalic acid |
Catalog Number | HY-Y0251 |
Alternative Name(s) | m-Nitrophthalic acid; o-Nitrophthalic acid; 3-Nitrophthalic acid |
Research Area | Others |
CAS# | 603-11-2 |
Purity | ≥98.0% |
SMILES | O=C(C1=CC=CC([N+]([O-])=O)=C1C(O)=O)O |
Size | 100 g |
Supplier Page | https://www.medchemexpress.com/3-nitrophthalic-acid.html |