3-Nitrophthalic acid | MedChemExpress (MCE)
3-Nitrophthalic acid (m-Nitrophthalic acid; o-Nitrophthalic acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | 3-Nitrophthalic acid |
| Catalog Number | HY-Y0251 |
| Alternative Name(s) | m-Nitrophthalic acid; o-Nitrophthalic acid; 3-Nitrophthalic acid |
| Research Area | Others |
| CAS# | 603-11-2 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=CC([N+]([O-])=O)=C1C(O)=O)O |
| Size | 100 g |
| Supplier Page | https://www.medchemexpress.com/3-nitrophthalic-acid.html |