trans-Zeatin-riboside
Zeatin Riboside is the most active and ubiquitous form of the naturally occurring cytokinins that promote cell division, stimulate shoot proliferation, inhibit root formation, slow the aging process, and activate gene expression and metabolic activity. Zeatin riboside has an immunomodulatory effect by agonizing the mammalian adenosine A2A receptor.
| Trivial name | N/A |
| Catalog Number | S5678 |
| Molecular Formula | C19H12N2O |
| CAS# | 6025-53-2 |
| SMILES | O=CC1=C2C(=CC3=C1[NH]C4=C3C=CC=C4)[NH]C5=C2C=CC=C5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/trans-zeatin-riboside.html |
| Additional Information | https://file.selleck.cn/downloads/struct/trans-Zeatin-riboside-chemical-structure-s5678.gif |
