Tetrahydropalmatine hydrochloride
Tetrahydropalmatine (THP, Gindarine, 1-Tetrahydropalmitine) is an isoquinoline alkaloid found in several different plant species, mainly in the Corydalis genus (Yan Hu Suo), but also in other plants such as Stephania rotunda. It is a potent muscle relaxant. Tetrahydropalmatine hydrochloride acts through inhibition of amygdaloid release of dopamine to inhibit an epileptic attack in rats.
| Trivial name | Gindarine hydrochloride, 1-Tetrahydropalmitine HCl |
| Catalog Number | S3854 |
| Molecular Formula | C23H22ClN7O3 |
| CAS# | 6024-85-7 |
| Inchi | InChI=1S/C23H22ClN7O3/c1-23(2,12-32)31-11-18(17-10-28-22(25)30-21(17)31)20(34)13-5-16(9-26-7-13)29-19(33)6-15-4-3-14(24)8-27-15/h3-5,7-11,32H,6,12H2,1-2H3,(H,29,33)(H2,25,28,30) |
| Inchi Key | BPIWZDNVMQQBQX-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)N1C=C(C2=CN=C(N=C21)N)C(=O)C3=CC(=CN=C3)NC(=O)CC4=NC=C(C=C4)Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/tetrahydropalmatine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tetrahydropalmatine-hydrochloride-chemical-structure-s3854.gif |
